Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (1R,2R)-1-Amino-2-Ethylcyclopropanecarboxylate |
|---|---|
| Synonyms | (1R,2R)-methyl 1-amino-2-ethylcyclopropanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.18 |
| CAS Registry Number | 138457-96-2 |
| SMILES | CC[C@@H]1C[C@@]1(C(=O)OC)N |
| InChI | 1S/C7H13NO2/c1-3-5-4-7(5,8)6(9)10-2/h5H,3-4,8H2,1-2H3/t5-,7-/m1/s1 |
| InChIKey | OGJFOUDGUGGQPA-IYSWYEEDSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 173.67°C at 760 mmHg (Cal.) |
| Flash point | 46.797°C (Cal.) |
| Refractive index | 1.471 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (1R,2R)-1-Amino-2-Ethylcyclopropanecarboxylate |