Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (4-Benzhydrylphenyl)-Dimethylamine |
|---|---|
| Synonyms | 4-[Di(Phenyl)Methyl]-N,N-Dimethyl-Aniline; [4-[Di(Phenyl)Methyl]Phenyl]-Dimethyl-Amine; Brn 2848262 |
| Molecular Structure |  |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.40 |
| CAS Registry Number | 13865-57-1 |
| SMILES | C1=CC(=CC=C1N(C)C)C(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C21H21N/c1-22(2)20-15-13-19(14-16-20)21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16,21H,1-2H3 |
| InChIKey | CMWPUDHQIUJSCD-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.56°C at 760 mmHg (Cal.) |
| Flash point | 167.928°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Benzhydrylphenyl)-Dimethylamine |