Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | 2-Methyl-2-Propanyl [(1S,2R)-2-Methyl-5-Oxocyclopentyl]Carbamate |
|---|---|
| Synonyms | (2-Methyl-5-oxo-cyclopentyl)-carbamic acid tert-butyl ester |
| Molecular Structure | ![CAS#: 138871-73-5， 2-Methyl-2-Propanyl [(1S,2R)-2-Methyl-5-Oxocyclopentyl]Carbamate](/moreStructures/138871-73-5.gif) |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.27 |
| CAS Registry Number | 138871-73-5 |
| SMILES | O=C1CC[C@@H](C)[C@@H]1NC(=O)OC(C)(C)C |
| InChI | 1S/C11H19NO3/c1-7-5-6-8(13)9(7)12-10(14)15-11(2,3)4/h7,9H,5-6H2,1-4H3,(H,12,14)/t7-,9+/m1/s1 |
| InChIKey | FFYYOUIUVZSYIJ-APPZFPTMSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.892°C at 760 mmHg (Cal.) |
| Flash point | 150.894°C (Cal.) |
| Refractive index | 1.472 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl [(1S,2R)-2-Methyl-5-Oxocyclopentyl]Carbamate |