Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-[2-(Butyryloxy)Propyl]Benzoic Acid |
|---|---|
| Synonyms | 4-(2-(butyryloxy)propyl)benzoic acid |
| Molecular Structure | ![CAS#: 138948-88-6， 4-[2-(Butyryloxy)Propyl]Benzoic Acid](/moreStructures/138948-88-6.gif) |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 |
| CAS Registry Number | 138948-88-6 |
| SMILES | CCCC(=O)OC(C)Cc1ccc(cc1)C(=O)O |
| InChI | 1S/C14H18O4/c1-3-4-13(15)18-10(2)9-11-5-7-12(8-6-11)14(16)17/h5-8,10H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | BHPWDSDRNHHEOQ-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 383.903°C at 760 mmHg (Cal.) |
| Flash point | 139.935°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[2-(Butyryloxy)Propyl]Benzoic Acid |