Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Vinyl-1H-Benzimidazole 3-Oxide |
|---|---|
| Synonyms | 2-vinyl-1H-benzo[d]imidazole 3-oxide |
| Molecular Structure |  |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.17 |
| CAS Registry Number | 138972-85-7 |
| SMILES | C=CC1=[N+](C2=CC=CC=C2N1)[O-] |
| InChI | 1S/C9H8N2O/c1-2-9-10-7-5-3-4-6-8(7)11(9)12/h2-6,10H,1H2 |
| InChIKey | GFCBMNQMXJISRH-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.5±25.0°C at 760 mmHg (Cal.) |
| Flash point | 181.5±23.2°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Vinyl-1H-Benzimidazole 3-Oxide |