| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Lys05 |
|---|---|
| Synonyms | LYS-05 HCl; LYS05; LYS-05; Lys01 trihydrochloride; Lys01 3HCl; N-(7-chloroquinolin-4-yl)-N'-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-N'-methylethane-1,2-diamine trihydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C23H26Cl5N5 |
| Molecular Weight | 549.75 |
| CAS Registry Number | 1391426-24-6 |
| SMILES | CN(CCNC1=C2C=CC(=CC2=NC=C1)Cl)CCNC3=C4C=CC(=CC4=NC=C3)Cl.Cl.Cl.Cl |
| InChI | 1S/C23H23Cl2N5.3ClH/c1-30(12-10-28-20-6-8-26-22-14-16(24)2-4-18(20)22)13-11-29-21-7-9-27-23-15-17(25)3-5-19(21)23;;;/h2-9,14-15H,10-13H2,1H3,(H,26,28)(H,27,29);3*1H |
| InChIKey | JTUYDBHQGOZPQQ-UHFFFAOYSA-N |
| solubility | Soluble to 6.4 mg/mL in water. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Lys05 |