| Eburon Organics bvba | Belgium | Inquire | ||
|---|---|---|---|---|
![]() |
+32 (51) 335-068 | |||
![]() |
sales@eburon-organics.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Phenylalanine derivatives |
|---|---|
| Name | (2S)-3-(2-Methylphenyl)-2-[(2-Methylpropan-2-Yl)Oxycarbonylamino]Propanoate |
| Synonyms | (2S)-2-(Tert-Butoxycarbonylamino)-3-(2-Methylphenyl)Propanoate; (2S)-2-[(Tert-Butoxy-Oxomethyl)Amino]-3-(2-Methylphenyl)Propanoate; (2S)-2-(Tert-Butoxycarbonylamino)-3-(2-Methylphenyl)Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20NO4 |
| Molecular Weight | 278.33 |
| CAS Registry Number | 139558-50-2 |
| SMILES | [C@H](NC(OC(C)(C)C)=O)(CC1=CC=CC=C1C)C([O-])=O |
| InChI | 1S/C15H21NO4/c1-10-7-5-6-8-11(10)9-12(13(17)18)16-14(19)20-15(2,3)4/h5-8,12H,9H2,1-4H3,(H,16,19)(H,17,18)/p-1/t12-/m0/s1 |
| InChIKey | PCGOCPOJLMLJAR-LBPRGKRZSA-M |
| Boiling point | 442.535°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 221.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-3-(2-Methylphenyl)-2-[(2-Methylpropan-2-Yl)Oxycarbonylamino]Propanoate |