Online Database of Chemicals from Around the World
|
CAS#: 13992-53-5 Product: 1,3-Dimethyl-6-(Methylamino)-5-Nitrouracil No suppilers available for the product. |
| Name | 1,3-Dimethyl-6-(Methylamino)-5-Nitrouracil |
|---|---|
| Synonyms | 1,3-Dimethyl-6-Methylamino-5-Nitro-Pyrimidine-2,4-Dione; 1,3-Dimethyl-6-Methylamino-5-Nitro-Pyrimidine-2,4-Quinone; 2,4(1H,3H)-Pyrimidinedione, 1,3-Dimethyl-6-(Methylamino)-5-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 |
| CAS Registry Number | 13992-53-5 |
| SMILES | CN1C(=C([N+]([O-])=O)C(=O)N(C1=O)C)NC |
| InChI | 1S/C7H10N4O4/c1-8-5-4(11(14)15)6(12)10(3)7(13)9(5)2/h8H,1-3H3 |
| InChIKey | YPENWWBLQQJRDL-UHFFFAOYSA-N |
| Density | 1.462g/cm3 (Cal.) |
|---|---|
| Boiling point | 272.83°C at 760 mmHg (Cal.) |
| Flash point | 118.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dimethyl-6-(Methylamino)-5-Nitrouracil |