| Chemfish Tokyo Co., Ltd. | Japan | Inquire | ||
|---|---|---|---|---|
![]() | www.chemfish.co.jp | |||
![]() | +080 46541159 | |||
![]() | sunnyjiao@chemfish.co.jp | |||
| Chemical distributor since 2012 | ||||
| chemBlink Standard supplier since 2021 | ||||
| Name | Lisuride |
|---|---|
| Synonyms | 3-[(6aR,9S)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinolin-9-yl]-1,1-diethylurea |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.45 |
| CAS Registry Number | 140387-89-9 |
| EC Number | 241-925-1 |
| SMILES | CCN(CC)C(=O)N[C@@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C |
| Solubility | 5.694 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.659, Calc.* |
| Melting point | 223.24 °C |
| Boiling Point | 522.79 °C, 603.4±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 318.7±31.5 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Lisuride |