Online Database of Chemicals from Around the World
(R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol
[CAS# 140710-96-9]
Identification| Name | (R)-6-((1R,3aS,7aR,E)-4-((Z)-2-((3S,5R)-3,5-bis(tert-butyldimethylsilyloxy)-2-methylenecyclohexylidene)ethylidene)-7a-methyloctahydro-1H-inden-1-yl)-2-methylheptan-2-ol |
|---|
|
| Molecular Structure |  |
| Molecular Formula | C39H72O3Si2 |
| Molecular Weight | 645.16 |
| CAS Registry Number | 140710-96-9 |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@@H]2[C@@]1(CCC/C2=CC=C/3C[C@H](C[C@@H](C3=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C |
|
Properties
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.499, Calc.* |
| Boiling Point | 621.9±55.0 °C (760 mmHg), Calc.* |
| Flash Point | 329.9±31.5 °C, Calc.* |
|
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
Related Products
(4S)-4,6-Bis-{[... rac-8,14-Bis(te... 1,2-Bis(tert-bu... (2S,3S,4R)-3,4-... 4-[[(4S,6R)-4,6... (3S,6R,7S,12Z,1... (1R,2S,4R,6R)-2... (3S,5S)-3,5-Bis... (3S,5S)-3,5-Bis... [3S-(1Z,3a,5b)]... (2E,4R)-4-[(1R,... N,N’-Bis[(S)-1-... (4S,7R,8S,9S,13... (1S,3R,5E,7E)-1... 4-[(1E,3S,5Z,8R... 4-[(1E,3S,5Z,8R... 3,5-Bis(tert-bu... Bis(tert-butyld... [(2R,3R,4R,5R)-... [4-[3,3-bis[2-t...