Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Ethoxy-1-Ethyl-3,3-Dimethylindoline |
|---|---|
| Synonyms | 6-ethoxy-1-ethyl-3,3-dimethylindoline |
| Molecular Structure |  |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.32 |
| CAS Registry Number | 141315-04-0 |
| SMILES | CCN1CC(c2c1cc(cc2)OCC)(C)C |
| InChI | 1S/C14H21NO/c1-5-15-10-14(3,4)12-8-7-11(16-6-2)9-13(12)15/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | RKTKOFGIJCUHJM-UHFFFAOYSA-N |
| Density | 0.97g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.185°C at 760 mmHg (Cal.) |
| Flash point | 94.572°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Ethoxy-1-Ethyl-3,3-Dimethylindoline |