|
CAS#: 14140-18-2 Product: (2S,3R)-2,3-Dihydroxy-2-Isopropylbutanoic Acid [(1R,7aS)-2,3,5,6,7,7a-Hexahydro-1H-Pyrrolizin-1-Yl]Methyl Ester No suppilers available for the product. |
| Name | (2S,3R)-2,3-Dihydroxy-2-Isopropylbutanoic Acid [(1R,7aS)-2,3,5,6,7,7a-Hexahydro-1H-Pyrrolizin-1-Yl]Methyl Ester |
|---|---|
| Synonyms | Trachelanthamin; Trachelanthamine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 |
| CAS Registry Number | 14140-18-2 |
| SMILES | [C@H]12[C@H](CCN1CCC2)COC([C@@](C(C)C)(C(C)O)O)=O |
| InChI | 1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11?,12-,13+,15-/m1/s1 |
| InChIKey | BWQSLRZZOVFVHJ-VYHDIPPYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 413.494°C at 760 mmHg (Cal.) |
| Flash point | 203.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S,3R)-2,3-Dihydroxy-2-Isopropylbutanoic Acid [(1R,7aS)-2,3,5,6,7,7a-Hexahydro-1H-Pyrrolizin-1-Yl]Methyl Ester |