Online Database of Chemicals from Around the World
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (843)-884-4911 | |||
 |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Methylenedinitramine |
|---|---|
| Synonyms | 4-01-00-03059 (Beilstein Handbook Reference); Brn 1812518; Medina |
| Molecular Structure |  |
| Molecular Formula | CH4N4O4 |
| Molecular Weight | 136.07 |
| CAS Registry Number | 14168-44-6 |
| SMILES | C(N[N+]([O-])=O)N[N+]([O-])=O |
| InChI | 1S/CH4N4O4/c6-4(7)2-1-3-5(8)9/h2-3H,1H2 |
| InChIKey | HSMJRIUFXFAZSY-UHFFFAOYSA-N |
| Density | 1.542g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.403°C at 760 mmHg (Cal.) |
| Flash point | 149.389°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methylenedinitramine |