Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Diallylsulfone |
|---|---|
| Synonyms | 3-Allylsulfinylprop-1-Ene; Inchi=1/C6h10os/C1-3-5-8(7)6-4-2/H3-4H,1-2,5-6H; Diallyl Sulfoxide |
| Molecular Structure |  |
| Molecular Formula | C6H10OS |
| Molecular Weight | 130.20 |
| CAS Registry Number | 14180-63-3 |
| SMILES | C([S](=O)CC=C)C=C |
| InChI | 1S/C6H10OS/c1-3-5-8(7)6-4-2/h3-4H,1-2,5-6H2 |
| InChIKey | XYGIHYNABFJESU-UHFFFAOYSA-N |
| Density | 1.023g/cm3 (Cal.) |
|---|---|
| Boiling point | 245.531°C at 760 mmHg (Cal.) |
| Flash point | 102.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diallylsulfone |