| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | 3,5-Bis{[(2,2-Dimethylpropanoyl)Oxy]Methoxy}-4-(4-Hydroxyphenoxy)-4,10,10-Trimethyl-3,5-Dioxido-9-Oxo-2,6,8-Trioxa-3lambda5,5lambda5-Diphosphaundec-1-Yl Pivalate |
|---|---|
| Synonyms | [142523-14-6]; 1-[(4-Hyd |
| Molecular Structure | ![]() |
| Molecular Formula | C32H52O16P2 |
| Molecular Weight | 754.69 |
| CAS Registry Number | 142523-14-6 |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(C(C)(OC1=CC=C(C=C1)O)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | 1S/C32H52O16P2/c1-28(2,3)24(34)40-18-44-49(38,45-19-41-25(35)29(4,5)6)32(13,48-23-16-14-22(33)15-17-23)50(39,46-20-42-26(36)30(7,8)9)47-21-43-27(37)31(10,11)12/h14-17,33H,18-21H2,1-13H3 |
| InChIKey | LOTSPVPQHAUHCE-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 754.8±60.0°C at 760 mmHg (Cal.) |
| Flash point | 410.3±32.9°C (Cal.) |
| Refractive index | 1.494 (Cal.) |
| solubility | Soluble to 100 mM in ethanol and to 100 mM in DMSO |