Online Database of Chemicals from Around the World
| Name | 1,6-Dihydroxy-2-Methoxyanthraquinone |
|---|---|
| Synonyms | 1,6-Dihydroxy-2-Methoxy-Anthracene-9,10-Dione; 1,6-Dihydroxy-2-Methoxy-9,10-Anthraquinone; 1,6-Dhma |
| Molecular Structure |  |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 142878-32-8 |
| SMILES | C1=C2C(=C(O)C(=C1)OC)C(=O)C3=C(C2=O)C=C(O)C=C3 |
| InChI | 1S/C15H10O5/c1-20-11-5-4-9-12(15(11)19)14(18)8-3-2-7(16)6-10(8)13(9)17/h2-6,16,19H,1H3 |
| InChIKey | HULRBUQQNBFVIW-UHFFFAOYSA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.103°C at 760 mmHg (Cal.) |
| Flash point | 192.65°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dihydroxy-2-Methoxyanthraquinone |
