Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 | www.bocsci.com | |||
 | +1 (631) 485-4226 | |||
 | +1 (631) 614-7828 | |||
 | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | Acyclovir L-Isoleucinate |
|---|---|
| Synonyms | 2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]ethyl (2S,3S)-2-amino-3-methylpentanoate |
| Molecular Structure |  |
| Molecular Formula | C14H22N6O4 |
| Molecular Weight | 338.36 |
| CAS Registry Number | 142963-63-1 |
| SMILES | CC[C@H](C)[C@@H](C(=O)OCCOCN1C=NC2=C1N=C(NC2=O)N)N |
| Solubility | 1 mg/L (25 °C water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.659, Calc.* |
| Melting point | 244.74 °C |
| Boiling Point | 568.81 °C, 592.8±60.0 °C (760 mmHg), Calc.* |
| Flash Point | 312.3±32.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Acyclovir L-Isoleucinate |