| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl N-Acetyl-3-Methyl-L-Valinate |
|---|---|
| Synonyms | (S)-methyl 2-acetamido-3,3-dimethylbutanoate; N-Acetyl tert-leucine methyl ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 |
| CAS Registry Number | 143005-55-4 |
| SMILES | CC(=O)N[C@H](C(=O)OC)C(C)(C)C |
| InChI | 1S/C9H17NO3/c1-6(11)10-7(8(12)13-5)9(2,3)4/h7H,1-5H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | MNKLWOGVQOMQHS-SSDOTTSWSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 285.1±13.0°C at 760 mmHg (Cal.) |
| Flash point | 126.2±19.8°C (Cal.) |
| Refractive index | 1.438 (Cal.) |
| (1) | Axel G. Griesbeck and Heike Heckroth. Photofragmentation of C,N-protected a-amino acids: comparing tert-leucine with sulfur-containing amino acids methionine and cysteine, Photochem. Photobiol. Sci., 2003, 2, 1130. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl N-Acetyl-3-Methyl-L-Valinate |