Online Database of Chemicals from Around the World
|
CAS#: 143034-62-2 Product: 4-Methoxy-2H-Benzo[h]Chromene-3-Carbaldehyde No suppilers available for the product. |
| Name | 4-Methoxy-2H-Benzo[h]Chromene-3-Carbaldehyde |
|---|---|
| Synonyms | 4-Methoxy-2H-benzo[h]chromene-3-carbaldehyde |
| Molecular Structure | ![CAS#: 143034-62-2， 4-Methoxy-2H-Benzo[h]Chromene-3-Carbaldehyde](/moreStructures/143034-62-2.gif) |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25 |
| CAS Registry Number | 143034-62-2 |
| SMILES | COC1=C(COc2c1ccc3c2cccc3)C=O |
| InChI | 1S/C15H12O3/c1-17-14-11(8-16)9-18-15-12-5-3-2-4-10(12)6-7-13(14)15/h2-8H,9H2,1H3 |
| InChIKey | LDQRJFRDACUNSY-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 459.236°C at 760 mmHg (Cal.) |
| Flash point | 223.569°C (Cal.) |
| Refractive index | 1.645 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methoxy-2H-Benzo[h]Chromene-3-Carbaldehyde |