Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Amadis Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 (571) 8992-5085 | |||
|
sales@amadischem.com | |||
 |
Skype Chat | |||
| Chemical manufacturer since 2011 | ||||
| Name | 3-Methyl-N-(4-Phenyl-2-Butanyl)Butanamide |
|---|---|
| Synonyms | N-(1-Methyl-3-phenylpropyl)isovaleramide |
| Molecular Structure |  |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 |
| CAS Registry Number | 143085-87-4 |
| SMILES | O=C(NC(CCc1ccccc1)C)CC(C)C |
| InChI | 1S/C15H23NO/c1-12(2)11-15(17)16-13(3)9-10-14-7-5-4-6-8-14/h4-8,12-13H,9-11H2,1-3H3,(H,16,17) |
| InChIKey | KIJQPTRIOXCOEG-UHFFFAOYSA-N |
| Density | 0.954g/cm3 (Cal.) |
|---|---|
| Melting point | 52°C (Expl.) |
| Boiling point | 392.672°C at 760 mmHg (Cal.) |
| Flash point | 239.13°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-N-(4-Phenyl-2-Butanyl)Butanamide |