Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Isopropyl-2,3-Dimethylpyrazine 1-Oxide |
|---|---|
| Synonyms | 6-isopropyl-2,3-dimethylpyrazine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 |
| CAS Registry Number | 143463-82-5 |
| SMILES | Cc1c([n+](c(cn1)C(C)C)[O-])C |
| InChI | 1S/C9H14N2O/c1-6(2)9-5-10-7(3)8(4)11(9)12/h5-6H,1-4H3 |
| InChIKey | ZISRRVLIYGWHTF-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.078°C at 760 mmHg (Cal.) |
| Flash point | 161.893°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Isopropyl-2,3-Dimethylpyrazine 1-Oxide |