Online Database of Chemicals from Around the World
|
CAS#: 14358-42-0 Product: Glyoxal Bis(Guanylhydrazone) No suppilers available for the product. |
| Name | Glyoxal Bis(Guanylhydrazone) |
|---|---|
| Synonyms | 2-[2-(Diaminomethylidenehydrazinylidene)Ethylideneamino]Guanidine; 2-[2-(Diaminomethylenehydrazono)Ethylideneamino]Guanidine; 2-[[(2E)-2-(Diaminomethylenehydrazono)Ethylidene]Amino]Guanidine |
| Molecular Structure |  |
| Molecular Formula | C4H10N8 |
| Molecular Weight | 170.18 |
| CAS Registry Number | 14358-42-0 |
| SMILES | C(N)(N)=N\N=C\C=N\N=C(N)N |
| InChI | 1S/C4H10N8/c5-3(6)11-9-1-2-10-12-4(7)8/h1-2H,(H4,5,6,11)(H4,7,8,12)/b9-1+,10-2+ |
| InChIKey | JCJMVSDVPRRNSU-UVEKSMONSA-N |
| Density | 1.654g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.376°C at 760 mmHg (Cal.) |
| Flash point | 223.761°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Glyoxal Bis(Guanylhydrazone) |