| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | 4-Isocyanato-2-(trifluoromethyl)benzonitrile |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H3F3N2O |
| Molecular Weight | 212.13 |
| CAS Registry Number | 143782-18-7 |
| EC Number | 689-701-6 |
| SMILES | C1=CC(=C(C=C1N=C=O)C(F)(F)F)C#N |
| Solubility | 46.06 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.498, Calc.* |
| Melting point | 46.04 °C |
| Boiling Point | 243.38 °C, 268.2±40.0 °C (760 mmHg), Calc.* |
| Flash Point | 116.0±27.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H301+H331-H315-H318-H317-H334-H335 Details | ||||||||||||||||||||
| Safety Statements | P501-P261-P272-P270-P271-P264-P280-P284-P302+P352-P342+P311-P362+P364-P333+P313-P301+P310+P330-P304+P340+P311-P305+P351+P338+P310-P403+P233-P405 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4-Isocyanato-2-(trifluoromethyl)benzonitrile |