|
CAS#: 144540-04-5 Product: (5R,8S)-8-Hydroxy-1,7-Diazaspiro[4.4]Nonane-2,6-Dione No suppilers available for the product. |
| Name | (5R,8S)-8-Hydroxy-1,7-Diazaspiro[4.4]Nonane-2,6-Dione |
|---|---|
| Synonyms | (5R,8S)-8-hydroxy-1,7-diazaspiro[4.4]nonane-2,6-dione; 1,7-Diazaspiro[4.4]nonane-2,6-dione,8-hydroxy-,(5R-cis)- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 |
| CAS Registry Number | 144540-04-5 |
| SMILES | C1C[C@]2(C[C@@H](NC2=O)O)NC1=O |
| InChI | 1S/C7H10N2O3/c10-4-1-2-7(9-4)3-5(11)8-6(7)12/h5,11H,1-3H2,(H,8,12)(H,9,10)/t5-,7+/m0/s1 |
| InChIKey | QFDNETLFCLSOQH-CAHLUQPWSA-N |
| Density | 1.473g/cm3 (Cal.) |
|---|---|
| Boiling point | 636.809°C at 760 mmHg (Cal.) |
| Flash point | 338.93°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5R,8S)-8-Hydroxy-1,7-Diazaspiro[4.4]Nonane-2,6-Dione |