|
CAS#: 14458-12-9 Product: 2-((4-Chlorophenyl)Azo)Pyridine No suppilers available for the product. |
| Name | 2-((4-Chlorophenyl)Azo)Pyridine |
|---|---|
| Synonyms | (4-Chlorophenyl)-(2-Pyridyl)Diazene; (4-Chlorophenyl)-Pyridin-2-Yl-Diazene; Nsc170602 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.66 |
| CAS Registry Number | 14458-12-9 |
| SMILES | C1=CC(=NC=C1)N=NC2=CC=C(C=C2)Cl |
| InChI | 1S/C11H8ClN3/c12-9-4-6-10(7-5-9)14-15-11-3-1-2-8-13-11/h1-8H |
| InChIKey | SWWILIMFRGAWGS-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 359.72°C at 760 mmHg (Cal.) |
| Flash point | 171.353°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-((4-Chlorophenyl)Azo)Pyridine |