Online Database of Chemicals from Around the World
|
CAS#: 14458-76-5 Product: (1H)-Benzo[b]Fluorene No suppilers available for the product. |
| Name | (1H)-Benzo[b]Fluorene |
|---|---|
| Synonyms | (1H)-Benzo(B)Fluorene |
| Molecular Structure | ![CAS#: 14458-76-5， (1H)-Benzo[b]Fluorene](/moreStructures/14458-76-5.gif) |
| Molecular Formula | C17H12 |
| Molecular Weight | 216.28 |
| CAS Registry Number | 14458-76-5 |
| EINECS | 238-449-1 |
| SMILES | C1=C3C(=CC2=CC=CC=C12)C=C4C3=CC=CC4 |
| InChI | 1S/C17H12/c1-2-6-13-11-17-15(9-12(13)5-1)10-14-7-3-4-8-16(14)17/h1-6,8-11H,7H2 |
| InChIKey | RZKOXMMPOZMIOS-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.908°C at 760 mmHg (Cal.) |
| Flash point | 251.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1H)-Benzo[b]Fluorene |