Online Database of Chemicals from Around the World
| Name | 3-Benzyl-6-Isopropyl-2,5-Piperazinedione |
|---|---|
| Synonyms | 3-Isopropyl-6-(Phenylmethyl)Piperazine-2,5-Dione; 3-(Benzyl)-6-Isopropyl-Piperazine-2,5-Quinone; 3-(Phenylmethyl)-6-Propan-2-Yl-Piperazine-2,5-Dione |
| Molecular Structure |  |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 |
| CAS Registry Number | 14474-71-6 |
| SMILES | C2=C(CC1NC(C(C(C)C)NC1=O)=O)C=CC=C2 |
| InChI | 1S/C14H18N2O2/c1-9(2)12-14(18)15-11(13(17)16-12)8-10-6-4-3-5-7-10/h3-7,9,11-12H,8H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | OQQPOHUVAQPSHJ-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.574°C at 760 mmHg (Cal.) |
| Flash point | 210.383°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Benzyl-6-Isopropyl-2,5-Piperazinedione |
