Online Database of Chemicals from Around the World
|
CAS#: 14513-20-3 Product: L-alpha-Methyldopamine No suppilers available for the product. |
| Name | L-alpha-Methyldopamine |
|---|---|
| Synonyms | 4-[(2S)-2-Aminopropyl]Pyrocatechol; (+)-Deoxycobefrin; (+)-Deoxycobephrine |
| Molecular Structure |  |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 |
| CAS Registry Number | 14513-20-3 |
| SMILES | [C@@H](N)(CC1=CC=C(O)C(=C1)O)C |
| InChI | 1S/C9H13NO2/c1-6(10)4-7-2-3-8(11)9(12)5-7/h2-3,5-6,11-12H,4,10H2,1H3/t6-/m0/s1 |
| InChIKey | KSRGADMGIRTXAF-LURJTMIESA-N |
| Density | 1.197g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.607°C at 760 mmHg (Cal.) |
| Flash point | 157.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-alpha-Methyldopamine |