|
CAS#: 14545-01-8 Product: 1-(2,4-Dinitrophenyl)Imidazole No suppilers available for the product. |
| Name | 1-(2,4-Dinitrophenyl)Imidazole |
|---|---|
| Synonyms | Nsc226251; Imidazole, 1-(2,4-Dinitrophenyl)-; Nsc 226251 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6N4O4 |
| Molecular Weight | 234.17 |
| CAS Registry Number | 14545-01-8 |
| SMILES | C1=CC(=C(C=C1[N+]([O-])=O)[N+]([O-])=O)[N]2C=CN=C2 |
| InChI | 1S/C9H6N4O4/c14-12(15)7-1-2-8(9(5-7)13(16)17)11-4-3-10-6-11/h1-6H |
| InChIKey | DDUTWQBMJHOFNK-UHFFFAOYSA-N |
| Density | 1.596g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.633°C at 760 mmHg (Cal.) |
| Flash point | 220.892°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dinitrophenyl)Imidazole |