| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() | www.rdscientific.com | |||
![]() | +1 (226) 600-0236 | |||
![]() | sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 4-Bromo-2-methoxybenzene-1-sulfonyl chloride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H6BrClO3S |
| Molecular Weight | 285.54 |
| CAS Registry Number | 145915-29-3 |
| EC Number | 827-356-7 |
| SMILES | COC1=C(C=CC(=C1)Br)S(=O)(=O)Cl |
| Solubility | 6.791 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.569, Calc.* |
| Melting point | 116.01 °C |
| Boiling Point | 340.32 °C, 329.2±27.0 °C (760 mmHg), Calc.* |
| Flash Point | 152.9±23.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H302-H314 Details | ||||||||||||
| Safety Statements | P280-P305+P351+P338-P310 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| SDS | Available | ||||||||||||
| Market Analysis Reports |
| List of Reports Available for 4-Bromo-2-methoxybenzene-1-sulfonyl chloride |