|
CAS#: 145929-76-6 Product: 2-Methyl-2-Propanyl (4S)-4-[(2S)-2-Butanyl]-2,5-Dioxo-1,3-Oxazolidine-3-Carboxylate No suppilers available for the product. |
| Name | 2-Methyl-2-Propanyl (4S)-4-[(2S)-2-Butanyl]-2,5-Dioxo-1,3-Oxazolidine-3-Carboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.28 |
| CAS Registry Number | 145929-76-6 |
| SMILES | CC[C@H](C)[C@H]1C(=O)OC(=O)N1C(=O)OC(C)(C)C |
| InChI | 1S/C12H19NO5/c1-6-7(2)8-9(14)17-10(15)13(8)11(16)18-12(3,4)5/h7-8H,6H2,1-5H3/t7-,8-/m0/s1 |
| InChIKey | LXDDJFOBMDAQJT-YUMQZZPRSA-N |
| Density | 1.172g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.736°C at 760 mmHg (Cal.) |
| Flash point | 135.076°C (Cal.) |
| Refractive index | 1.481 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl (4S)-4-[(2S)-2-Butanyl]-2,5-Dioxo-1,3-Oxazolidine-3-Carboxylate |