Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-[(1R,2R)-1,2-Dimethylcyclohexyl]Ethanone |
|---|---|
| Synonyms | 1-((1R,2R)-1,2-dimethylcyclohexyl)ethanone |
| Molecular Structure | ![CAS#: 146076-46-2， 1-[(1R,2R)-1,2-Dimethylcyclohexyl]Ethanone](/moreStructures/146076-46-2.gif) |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 146076-46-2 |
| SMILES | C[C@@H]1CCCC[C@@]1(C)C(=O)C |
| InChI | 1S/C10H18O/c1-8-6-4-5-7-10(8,3)9(2)11/h8H,4-7H2,1-3H3/t8-,10-/m1/s1 |
| InChIKey | HYKXDAINNKOBKZ-PSASIEDQSA-N |
| Density | 0.876g/cm3 (Cal.) |
|---|---|
| Boiling point | 202.801°C at 760 mmHg (Cal.) |
| Flash point | 81.96°C (Cal.) |
| Refractive index | 1.438 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1R,2R)-1,2-Dimethylcyclohexyl]Ethanone |