|
CAS#: 14623-68-8 Product: 2-(4-Amino-N-Ethylanilino)Ethanol Sulphate No suppilers available for the product. |
| Name | 2-(4-Amino-N-Ethylanilino)Ethanol Sulphate |
|---|---|
| Synonyms | (P-Ammoniophenyl)Ethyl(2-Hydroxyethyl)Ammonium Sulphate; Ethanol, 2-((4-Aminophenyl)Ethylamino)-, Sulfate (1:1) (Salt) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.32 |
| CAS Registry Number | 14623-68-8 |
| EINECS | 224-361-0 |
| SMILES | O=[S](=O)(O)O.C1=C(C=CC(=C1)N)CCNCCO |
| InChI | 1S/C10H16N2O.H2O4S/c11-10-3-1-9(2-4-10)5-6-12-7-8-13;1-5(2,3)4/h1-4,12-13H,5-8,11H2;(H2,1,2,3,4) |
| InChIKey | ISJLPPKOXNTVPP-UHFFFAOYSA-N |
| Boiling point | 377.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 181.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Amino-N-Ethylanilino)Ethanol Sulphate |