Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6,6-Dimethylbicyclo[3.1.1]Hept-2-Ene-2-Carbonyl Chloride |
|---|---|
| Synonyms | 6,6-Dimethylbicyclo[3.1.1]hept-2-ene-2-carbonyl chloride #; Myrtene acid chloride |
| Molecular Structure | ![CAS#: 146254-24-2， 6,6-Dimethylbicyclo[3.1.1]Hept-2-Ene-2-Carbonyl Chloride](/moreStructures/146254-24-2.gif) |
| Molecular Formula | C10H13ClO |
| Molecular Weight | 184.66 |
| CAS Registry Number | 146254-24-2 |
| SMILES | ClC(=O)/C1=C/CC2CC1C2(C)C |
| InChI | 1S/C10H13ClO/c1-10(2)6-3-4-7(9(11)12)8(10)5-6/h4,6,8H,3,5H2,1-2H3 |
| InChIKey | OFMPGNCKUYNNHY-UHFFFAOYSA-N |
| Density | 1.147g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.589°C at 760 mmHg (Cal.) |
| Flash point | 101.464°C (Cal.) |
| Refractive index | 1.516 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6-Dimethylbicyclo[3.1.1]Hept-2-Ene-2-Carbonyl Chloride |