Online Database of Chemicals from Around the World
|
CAS#: 14628-06-9 Product: 2-Methyl-8-quinolyl N-methylcarbamate No suppilers available for the product. |
| Name | 2-Methyl-8-quinolyl N-methylcarbamate |
|---|---|
| Synonyms | (2-Methyl-8-Quinolyl) N-Methylcarbamate; N-Methylcarbamic Acid (2-Methyl-8-Quinolyl) Ester; Giegy Gs-13798 |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 |
| CAS Registry Number | 14628-06-9 |
| SMILES | C1=C2C(=C(C=C1)OC(NC)=O)N=C(C)C=C2 |
| InChI | 1S/C12H12N2O2/c1-8-6-7-9-4-3-5-10(11(9)14-8)16-12(15)13-2/h3-7H,1-2H3,(H,13,15) |
| InChIKey | VJTZIJOEPIURRT-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.063°C at 760 mmHg (Cal.) |
| Flash point | 162.489°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-8-quinolyl N-methylcarbamate |