Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| CiVentiChem - Simple Solutions for Complex Chemistry | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (919) 678-0702 | |||
|
sales@cvchem.com | |||
| Chemical manufacturer since 1994 | ||||
| Name | (2R,3S,4R)-6,8-Dioxabicyclo[3.2.1]Octane-2,3,4-Triyl Triacetate |
|---|---|
| Synonyms | 1,6-Anhydro-2,3,4-tri-O-acetyl-b-glucopyranose |
| Molecular Structure | ![CAS#: 14661-13-3， (2R,3S,4R)-6,8-Dioxabicyclo[3.2.1]Octane-2,3,4-Triyl Triacetate](/moreStructures/14661-13-3.gif) |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25 |
| CAS Registry Number | 14661-13-3 |
| SMILES | CC(=O)O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)C1OC2CO1 |
| InChI | 1S/C12H16O8/c1-5(13)17-9-8-4-16-12(20-8)11(19-7(3)15)10(9)18-6(2)14/h8-12H,4H2,1-3H3/t8?,9-,10+,11-,12?/m1/s1 |
| InChIKey | BAKQMOSGYGQJOJ-QNHXCVIDSA-N |
| Density | 1.344g/cm3 (Cal.) |
|---|---|
| Boiling point | 392°C at 760 mmHg (Cal.) |
| Flash point | 147.326°C (Cal.) |
| Refractive index | 1.494 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,3S,4R)-6,8-Dioxabicyclo[3.2.1]Octane-2,3,4-Triyl Triacetate |