|
CAS#: 14674-17-0 Product: 2-(O-Nitrophenyl)Acetyl Hydrazide No suppilers available for the product. |
| Name | 2-(O-Nitrophenyl)Acetyl Hydrazide |
|---|---|
| Synonyms | N'-(2-Nitrophenyl)Ethanehydrazide; 4-15-00-00310 (Beilstein Handbook Reference); Acetic Acid, 2-(O-Nitrophenyl)Hydrazide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 |
| CAS Registry Number | 14674-17-0 |
| SMILES | C1=CC=CC(=C1NNC(C)=O)[N+](=O)[O-] |
| InChI | 1S/C8H9N3O3/c1-6(12)9-10-7-4-2-3-5-8(7)11(13)14/h2-5,10H,1H3,(H,9,12) |
| InChIKey | YEMZEMNLHVJVJK-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.796°C at 760 mmHg (Cal.) |
| Flash point | 132.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(O-Nitrophenyl)Acetyl Hydrazide |