Online Database of Chemicals from Around the World
| Name | Dipotassium Dihydrogenpyrophosphate |
|---|---|
| Synonyms | Dipotassium (Hydroxy-Oxido-Phosphoryl) Hydrogen Phosphate; Diphosphoric Acid, Dipotassium Salt; Dipotassium Dihydrogen Pyrophosphate |
| Molecular Structure |  |
| Molecular Formula | H2K2O7P2 |
| Molecular Weight | 254.16 |
| CAS Registry Number | 14691-84-0 |
| EINECS | 238-736-1 |
| SMILES | O=[P](O[P]([O-])(=O)O)([O-])O.[K+].[K+] |
| InChI | 1S/2K.H4O7P2/c;;1-8(2,3)7-9(4,5)6/h;;(H2,1,2,3)(H2,4,5,6)/q2*+1;/p-2 |
| InChIKey | CQAIPTBBCVQRMD-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Dipotassium Dihydrogenpyrophosphate |
