Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (609) 434-0144 | |||
|
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | 4-Methyl-3-Nitro-1,2-Benzenediamine |
|---|---|
| Synonyms | 3,4-Diamino-2-nitrotoluene |
| Molecular Structure |  |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 |
| CAS Registry Number | 147021-86-1 |
| SMILES | [O-][N+](=O)c1c(ccc(N)c1N)C |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 361.167°C at 760 mmHg (Cal.) |
| Flash point | 172.228°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-3-Nitro-1,2-Benzenediamine |