| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Ethyl (3-Amino-2-Oxo-1(2H)-Pyridinyl)Acetate |
|---|---|
| Synonyms | ethyl 2-(3-amino-2-oxohydropyridyl)acetate; ethyl 2-(3-amino-2-oxopyridin-1(2H)-yl)acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 147283-74-7 |
| SMILES | O=C(OCC)CN1/C=C\C=C(/C1=O)N |
| InChI | 1S/C9H12N2O3/c1-2-14-8(12)6-11-5-3-4-7(10)9(11)13/h3-5H,2,6,10H2,1H3 |
| InChIKey | BQWBDOJVEUYSPH-UHFFFAOYSA-N |
| Density | 1.224g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.112°C at 760 mmHg (Cal.) |
| Flash point | 183.081°C (Cal.) |
| Refractive index | 1.535 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (3-Amino-2-Oxo-1(2H)-Pyridinyl)Acetate |