|
CAS#: 147402-53-7 Product: 3-Methyl-5-[(2S)-1-Methylpyrrolidin-2-Yl]-1,2-Oxazole No suppilers available for the product. |
| Name | 3-Methyl-5-[(2S)-1-Methylpyrrolidin-2-Yl]-1,2-Oxazole |
|---|---|
| Synonyms | 3-Methyl-5-[(2S)-1-Methylpyrrolidin-2-Yl]Isoxazole; 3-Methyl-5-[(2S)-1-Methyl-2-Pyrrolidinyl]Isoxazole; Abt-418 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 |
| CAS Registry Number | 147402-53-7 |
| SMILES | [C@@H]1(N(CCC1)C)C2=CC(=NO2)C |
| InChI | 1S/C9H14N2O/c1-7-6-9(12-10-7)8-4-3-5-11(8)2/h6,8H,3-5H2,1-2H3/t8-/m0/s1 |
| InChIKey | ILLGYRJAYAAAEW-QMMMGPOBSA-N |
| Density | 1.064g/cm3 (Cal.) |
|---|---|
| Boiling point | 249.214°C at 760 mmHg (Cal.) |
| Flash point | 104.521°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-5-[(2S)-1-Methylpyrrolidin-2-Yl]-1,2-Oxazole |