Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 9H-Fluoren-9-Ylmethyl Methyl(2-Oxoethyl)Carbamate |
|---|---|
| Synonyms | (9H-Fluoren-9-yl)methyl methyl(2-oxoethyl)carbamate; (9H-Fluoren-9-yl)methyl methyl(2-oxoethyl)carbamate; (9H-Fluoren-9-yl)methylmethyl(2-oxoethyl)carbamate |
| Molecular Structure |  |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.33 |
| CAS Registry Number | 147687-06-7 |
| SMILES | CN(CC=O)C(=O)OCC1c2ccccc2-c3c1cccc3 |
| InChI | 1S/C18H17NO3/c1-19(10-11-20)18(21)22-12-17-15-8-4-2-6-13(15)14-7-3-5-9-16(14)17/h2-9,11,17H,10,12H2,1H3 |
| InChIKey | MEKHYFIFCBVDTM-UHFFFAOYSA-N |
| Density | 1.213g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.763°C at 760 mmHg (Cal.) |
| Flash point | 226.414°C (Cal.) |
| Refractive index | 1.595 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Fluoren-9-Ylmethyl Methyl(2-Oxoethyl)Carbamate |