Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2-Phenylethyl)-2,5-Pyrrolidinedithione |
|---|---|
| Synonyms | 1-phenethylpyrrolidine-2,5-dithione |
| Molecular Structure |  |
| Molecular Formula | C12H13NS2 |
| Molecular Weight | 235.37 |
| CAS Registry Number | 147767-16-6 |
| SMILES | c1ccc(cc1)CCN2C(=S)CCC2=S |
| InChI | 1S/C12H13NS2/c14-11-6-7-12(15)13(11)9-8-10-4-2-1-3-5-10/h1-5H,6-9H2 |
| InChIKey | OGPXJTKMLVTSRJ-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.853°C at 760 mmHg (Cal.) |
| Flash point | 170.828°C (Cal.) |
| Refractive index | 1.679 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Phenylethyl)-2,5-Pyrrolidinedithione |