|
CAS#: 1482-78-6 Product: (3alpha,5beta)-17-Oxoandrostan-3-Yl Acetate No suppilers available for the product. |
| Name | (3alpha,5beta)-17-Oxoandrostan-3-Yl Acetate |
|---|---|
| Synonyms | etiocholanolone acetate; ETIOCHOLANOLONEACETATE |
| Molecular Structure | ![]() |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 |
| CAS Registry Number | 1482-78-6 |
| SMILES | O=C(O[C@@H]3CC[C@@]4([C@@H]2[C@H]([C@H]1[C@@](C(=O)CC1)(CC2)C)CC[C@@H]4C3)C)C |
| InChI | 1S/C21H32O3/c1-13(22)24-15-8-10-20(2)14(12-15)4-5-16-17-6-7-19(23)21(17,3)11-9-18(16)20/h14-18H,4-12H2,1-3H3/t14-,15-,16+,17+,18+,20+,21+/m1/s1 |
| InChIKey | FDCINQSOYQUNKB-YHKBIIBQSA-N |
| Density | 1.099g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.64°C at 760 mmHg (Cal.) |
| Flash point | 182.816°C (Cal.) |
| Refractive index | 1.527 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3alpha,5beta)-17-Oxoandrostan-3-Yl Acetate |