| Interbioscreen Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (49) 6524-0091 | |||
![]() |
screen@ibscreen.chg.ru | |||
| Chemical manufacturer | ||||
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (732) 355-9920 | |||
![]() |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| ZereneX Molecular Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | DL-Isoproterenol |
|---|---|
| Synonyms | 4-[1-Hydroxy-2-(Isopropylamino)Ethyl]Benzene-1,2-Diol; 4-[1-Hydroxy-2-(Isopropylamino)Ethyl]Pyrocatechol; Spbio_001042 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 |
| CAS Registry Number | 149-53-1 (2964-04-7) |
| SMILES | C1=C(O)C(=CC=C1C(O)CNC(C)C)O |
| InChI | 1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3 |
| InChIKey | JWZZKOKVBUJMES-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.5±40.0°C at 760 mmHg (Cal.) |
| Flash point | 179.7±17.9°C (Cal.) |
| (1) | Yao, X., Parnot, C., Deupi, X., Ratnala, V.R.P., Swaminath, G., Farrens, D. & Kobilka, B.. Coupling ligand structure to specific conformational switches in the beta2-andrenoceptor, Nature Chemical Biology, 2006 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for DL-Isoproterenol |