| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Calyx Chemicals | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (213) 291-7773 | |||
![]() |
sales@calyxusa.com | |||
| Chemical manufacturer since 2007 | ||||
| SynQuest Labs, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (386) 462-0788 | |||
![]() |
info@synquestlabs.com | |||
| Chemical manufacturer | ||||
| Zylexa Pharma Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Lysine derivative |
|---|---|
| Name | N2-[(Benzyloxy)Carbonyl]-N6-(Trifluoroacetyl)-L-Lysine |
| Synonyms | MFCD00270524; N2-(Benzyloxycarbonyl)-N6-trifluoroacetyl-L-lysine; N2-(Benzyloxycarbonyl)-N6-trifluoroacetyl-L-lysine 95% |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19F3N2O5 |
| Molecular Weight | 376.33 |
| CAS Registry Number | 14905-30-7 |
| SMILES | FC(F)(F)C(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCc1ccccc1 |
| InChI | 1S/C16H19F3N2O5/c17-16(18,19)14(24)20-9-5-4-8-12(13(22)23)21-15(25)26-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10H2,(H,20,24)(H,21,25)(H,22,23)/t12-/m0/s1 |
| InChIKey | KJWAGCTWJDRZLH-LBPRGKRZSA-N |
| Density | 1.325g/cm3 (Cal.) |
|---|---|
| Melting point | 88-95°C (Expl.) |
| Boiling point | 566.161°C at 760 mmHg (Cal.) |
| Flash point | 296.204°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Safety Description | R36/37/38 |
|---|---|
| Irritant | |
| S24/25,S36/37/39,S45 | |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for N2-[(Benzyloxy)Carbonyl]-N6-(Trifluoroacetyl)-L-Lysine |