Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,4-Dimethyl-5-Nitro-Phenol |
|---|---|
| Synonyms | 2,4-dimethyl-5-nitrophenol |
| Molecular Structure |  |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 |
| CAS Registry Number | 14969-00-7 |
| SMILES | Cc1cc(C)c(O)cc1[N+]([O-])=O |
| InChI | 1S/C8H9NO3/c1-5-3-6(2)8(10)4-7(5)9(11)12/h3-4,10H,1-2H3 |
| InChIKey | OMVAMPJZESGWII-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.381°C at 760 mmHg (Cal.) |
| Flash point | 132.976°C (Cal.) |
| Refractive index | 1.585 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Dimethyl-5-Nitro-Phenol |