| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1H-Imidazo[4,5-h]Quinoline |
|---|---|
| Synonyms | 1H-Imidazo[4,5-h]quinoline; Imidazoquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 14993-03-4 |
| SMILES | C1=CC2=C(C3=C(C=C2)N=CN3)N=C1 |
| InChI | 1S/C10H7N3/c1-2-7-3-4-8-10(13-6-12-8)9(7)11-5-1/h1-6H,(H,12,13) |
| InChIKey | RHKWIGHJGOEUSM-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.8±18.0°C at 760 mmHg (Cal.) |
| Flash point | 248.2±14.2°C (Cal.) |
| Refractive index | 1.804 (Cal.) |
| (1) | Meng Wang, Yunhe Jin, Haijun Yang, Hua Fu and Liming Hu. Copper-catalyzed N-arylation and aerobic oxidative C–H/C–H coupling: one-pot synthesis of indoloimidazoquinoline derivatives, RSC Advances, 2013, 3, 8211. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1H-Imidazo[4,5-h]Quinoline |