|
CAS#: 150-74-3 Product: 4-(4-Fluorophenyl)Diazenyl-N,N-Dimethylaniline No suppilers available for the product. |
| Name | 4-(4-Fluorophenyl)Diazenyl-N,N-Dimethylaniline |
|---|---|
| Synonyms | 4-(4-Fluorophenyl)Azo-N,N-Dimethyl-Aniline; 4-(4-Fluorophenyl)Azo-N,N-Dimethylaniline; [4-(4-Fluorophenyl)Azophenyl]-Dimethyl-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.28 |
| CAS Registry Number | 150-74-3 |
| SMILES | C1=C(C=CC(=C1)N(C)C)N=NC2=CC=C(F)C=C2 |
| InChI | 1S/C14H14FN3/c1-18(2)14-9-7-13(8-10-14)17-16-12-5-3-11(15)4-6-12/h3-10H,1-2H3 |
| InChIKey | OQJQPXJGJJPOEK-UHFFFAOYSA-N |
| Density | 1.094g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.883°C at 760 mmHg (Cal.) |
| Flash point | 182.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Fluorophenyl)Diazenyl-N,N-Dimethylaniline |