| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Oxo(3,4,5-Trimethoxyphenyl)Acetaldehyde |
|---|---|
| Synonyms | 2-oxo-2-(3,4,5-trimethoxyphenyl)ethanal; 3,4,5-trimethoxylphenylglyoxal; NSC142535 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21 |
| CAS Registry Number | 150114-69-5 |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)C=O |
| InChI | 1S/C11H12O5/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3/h4-6H,1-3H3 |
| InChIKey | OWONHIWZFXFPFS-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 155.2±27.9°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Qianwen Peng, Zhijuan Cao, Choiwan Lau, Masaaki Kai and Jianzhong Lu. Aptamer-barcode based immunoassay for the instantaneous derivatization chemiluminescence detection of IgE coupled to magnetic beads, Analyst, 2011, 136, 140. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Oxo(3,4,5-Trimethoxyphenyl)Acetaldehyde |